| Product Name | ethyl 6-amino-5-cyano-2-methyl-4-(4-morpholinophenyl)-4H-pyran-3-carboxylate |
| CAS No. | 368870-01-3 |
| Synonyms | ethyl 6-amino-5-cyano-2-methyl-4-(4-morpholin-4-ylphenyl)-4H-pyran-3-carboxylate |
| InChI | InChI=1/C20H23N3O4/c1-3-26-20(24)17-13(2)27-19(22)16(12-21)18(17)14-4-6-15(7-5-14)23-8-10-25-11-9-23/h4-7,18H,3,8-11,22H2,1-2H3 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.4143 |
| Density | 1.28g/cm3 |
| Melting point | 152℃ |
| Boiling point | 614.7°C at 760 mmHg |
| Flash point | 325.6°C |
| Refractive index | 1.608 |
| Hazard Symbols | |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
368870-01-3 ethyl 6-amino-5-cyano-2-methyl-4-(4-morpholinophenyl)-4h-pyran-3-carboxylate
service@apichina.com