| Product Name | 4-(1H-pyrazol-1-yl)benzylamine |
| CAS No. | 368870-03-5 |
| Synonyms | 1-[4-(1H-pyrazol-1-yl)phenyl]methanamine; 4-(Pyrazol-1-yl)benzylamine |
| InChI | InChI=1/C10H11N3/c11-8-9-2-4-10(5-3-9)13-7-1-6-12-13/h1-7H,8,11H2 |
| Molecular Formula | C10H11N3 |
| Molecular Weight | 173.2144 |
| Density | 1.16g/cm3 |
| Melting point | 94℃ |
| Boiling point | 307.1°C at 760 mmHg |
| Flash point | 139.6°C |
| Refractive index | 1.622 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
368870-03-5 4-(1h-pyrazol-1-yl)benzylamine
service@apichina.com