| Product Name | 4-(4-chlorophenyl)cyclohexanecarbohydrazide |
| CAS No. | 368870-04-6 |
| InChI | InChI=1/C13H17ClN2O/c14-12-7-5-10(6-8-12)9-1-3-11(4-2-9)13(17)16-15/h5-9,11H,1-4,15H2,(H,16,17) |
| Molecular Formula | C13H17ClN2O |
| Molecular Weight | 252.7399 |
| Density | 1.204g/cm3 |
| Melting point | 208℃ |
| Boiling point | 444°C at 760 mmHg |
| Flash point | 222.3°C |
| Refractive index | 1.568 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
368870-04-6 4-(4-chlorophenyl)cyclohexanecarbohydrazide
service@apichina.com