| Product Name | 5-(2-methyl-1,3-thiazol-4-yl)-3-isoxazolecarboxylic acid |
| CAS No. | 368870-05-7 |
| Synonyms | 5-(2-methyl-1,3-thiazol-4-yl)isoxazole-3-carboxylic acid |
| InChI | InChI=1/C8H6N2O3S/c1-4-9-6(3-14-4)7-2-5(8(11)12)10-13-7/h2-3H,1H3,(H,11,12) |
| Molecular Formula | C8H6N2O3S |
| Molecular Weight | 210.2098 |
| Density | 1.477g/cm3 |
| Melting point | 167℃ |
| Boiling point | 482.6°C at 760 mmHg |
| Flash point | 245.7°C |
| Refractive index | 1.612 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
368870-05-7 5-(2-methyl-1,3-thiazol-4-yl)-3-isoxazolecarboxylic acid
service@apichina.com