| Product Name | 1-(4-chlorophenethyl)-5-oxo-3-pyrrolidinecarboxylic acid |
| CAS No. | 368870-06-8 |
| Synonyms | 1-[2-(4-chlorophenyl)ethyl]-5-oxopyrrolidine-3-carboxylic acid |
| InChI | InChI=1/C13H14ClNO3/c14-11-3-1-9(2-4-11)5-6-15-8-10(13(17)18)7-12(15)16/h1-4,10H,5-8H2,(H,17,18) |
| Molecular Formula | C13H14ClNO3 |
| Molecular Weight | 267.7082 |
| Density | 1.346g/cm3 |
| Melting point | 148℃ |
| Boiling point | 496.6°C at 760 mmHg |
| Flash point | 254.1°C |
| Refractive index | 1.588 |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
368870-06-8 1-(4-chlorophenethyl)-5-oxo-3-pyrrolidinecarboxylic acid
service@apichina.com