| Product Name | ethyl 6-amino-5-cyano-4-(2,3-dihydro-1-benzofuran-5-yl)-2-methyl-4H-pyran-3-carboxylate |
| CAS No. | 368870-00-2 |
| Synonyms | Ethyl 6-amino-5-cyano-4-(2,3-dihydro-1-benzofuran-5-yl)-2-methyl-4H-pyran-3-carboxyl |
| InChI | InChI=1/C18H18N2O4/c1-3-22-18(21)15-10(2)24-17(20)13(9-19)16(15)12-4-5-14-11(8-12)6-7-23-14/h4-5,8,16H,3,6-7,20H2,1-2H3 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.3465 |
| Density | 1.31g/cm3 |
| Melting point | 160℃ |
| Boiling point | 553.9°C at 760 mmHg |
| Flash point | 288.8°C |
| Refractive index | 1.611 |
| Hazard Symbols | |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
368870-00-2 ethyl 6-amino-5-cyano-4-(2,3-dihydro-1-benzofuran-5-yl)-2-methyl-4h-pyran-3-carboxylate
service@apichina.com