| Product Name | 6-Bromo-2-(2,6-dichlorobenzoyl)naphthalene |
| CAS No. | 216144-77-3 |
| Synonyms | (6-bromonaphthalen-2-yl)(2,6-dichlorophenyl)methanone |
| InChI | InChI=1/C17H9BrCl2O/c18-13-7-6-10-8-12(5-4-11(10)9-13)17(21)16-14(19)2-1-3-15(16)20/h1-9H |
| Molecular Formula | C17H9BrCl2O |
| Molecular Weight | 380.0628 |
| Density | 1.572g/cm3 |
| Boiling point | 500.5°C at 760 mmHg |
| Flash point | 256.5°C |
| Refractive index | 1.68 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
216144-77-3 6-bromo-2-(2,6-dichlorobenzoyl)naphthalene
service@apichina.com