| Product Name | 3-(2-Carboxyvinyl)benzeneboronic acid |
| CAS No. | 216144-91-1 |
| Synonyms | 3-(2-Carboxyvinyl)phenylboronic acid; 3-Boronocinnamic acid; (2E)-3-[3-(dihydroxyboranyl)phenyl]prop-2-enoic acid |
| InChI | InChI=1/C9H9BO4/c11-9(12)5-4-7-2-1-3-8(6-7)10(13)14/h1-6,13-14H,(H,11,12)/b5-4+ |
| Molecular Formula | C9H9BO4 |
| Molecular Weight | 191.9764 |
| Density | 1.33g/cm3 |
| Boiling point | 454.1°C at 760 mmHg |
| Flash point | 228.4°C |
| Refractive index | 1.591 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
216144-91-1 3-(2-carboxyvinyl)benzeneboronic acid
service@apichina.com