| Product Name | 6-Bromo-2-(2-chlorobenzoyl)naphthalene |
| CAS No. | 216144-73-9 |
| Synonyms | (6-bromonaphthalen-2-yl)(2-chlorophenyl)methanone |
| InChI | InChI=1/C17H10BrClO/c18-14-8-7-11-9-13(6-5-12(11)10-14)17(20)15-3-1-2-4-16(15)19/h1-10H |
| Molecular Formula | C17H10BrClO |
| Molecular Weight | 345.6177 |
| Density | 1.504g/cm3 |
| Boiling point | 472.6°C at 760 mmHg |
| Flash point | 239.6°C |
| Refractive index | 1.676 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
216144-73-9 6-bromo-2-(2-chlorobenzoyl)naphthalene
service@apichina.com