| Product Name | 5-iodo-2-phenoxypyridine |
| CAS No. | 352018-92-9 |
| InChI | InChI=1/C11H8INO/c12-9-6-7-11(13-8-9)14-10-4-2-1-3-5-10/h1-8H |
| Molecular Formula | C11H8INO |
| Molecular Weight | 297.0918 |
| Density | 1.694g/cm3 |
| Boiling point | 339.8°C at 760 mmHg |
| Flash point | 159.3°C |
| Refractive index | 1.646 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
352018-92-9 5-iodo-2-phenoxypyridine
service@apichina.com