| Product Name | (1,3,5-trimethyl-1H-pyrazol-4-yl)methylamine |
| CAS No. | 352018-93-0 |
| Synonyms | 1-(1,3,5-trimethyl-1H-pyrazol-4-yl)methanamine; (1,3,5-trimethyl-1H-pyrazol-4-yl)methanamine |
| InChI | InChI=1/C7H13N3/c1-5-7(4-8)6(2)10(3)9-5/h4,8H2,1-3H3 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.1982 |
| Density | 1.1g/cm3 |
| Boiling point | 247°C at 760 mmHg |
| Flash point | 103.2°C |
| Refractive index | 1.556 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
352018-93-0 (1,3,5-trimethyl-1h-pyrazol-4-yl)methylamine
service@apichina.com