| Product Name | 1-(4-cyanophenyl)-4-piperidinecarbohydrazide |
| CAS No. | 352018-91-8 |
| Synonyms | 1-(4-cyanophenyl)piperidine-4-carbohydrazide |
| InChI | InChI=1/C13H16N4O/c14-9-10-1-3-12(4-2-10)17-7-5-11(6-8-17)13(18)16-15/h1-4,11H,5-8,15H2,(H,16,18) |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.2923 |
| Density | 1.251g/cm3 |
| Boiling point | 528.975°C at 760 mmHg |
| Flash point | 273.715°C |
| Refractive index | 1.617 |
| Hazard Symbols | |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
352018-91-8 1-(4-cyanophenyl)-4-piperidinecarbohydrazide
service@apichina.com