| Product Name | 5-Chlorodibenzosuberane |
| CAS No. | 1210-33-9 |
| Synonyms | 5-Chloro-10,11-dihydro-5H-dibenzo[a,d]cycloheptene; 5-Chlorobenzosuberane; 5H-Dibenzo[a,d]cycloheptene, 5-chloro-10,11-dihydro-; 5-chloro-10,11-dihydro-5H-dibenzo[a,d][7]annulene; 5-Chloro dibenzosuberane; Dibenzosuberyl chloride; 5-Chloro dibenzosuberane; 5-Chloro-10,11-dihydro-5H-dibenzo[a,d]cycloheptene |
| InChI | InChI=1/C15H13Cl/c16-15-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)15/h1-8,15H,9-10H2 |
| Molecular Formula | C15H13Cl |
| Molecular Weight | 228.7167 |
| Density | 1.19g/cm3 |
| Boiling point | 321.738°C at 760 mmHg |
| Flash point | 136.593°C |
| Refractive index | 1.627 |
| Hazard Symbols |  34:; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
1210-33-9 5-chlorodibenzosuberane
service@apichina.com