| Product Name | Dibenzosuberol |
| CAS No. | 1210-34-0 |
| Synonyms | 10,11-Dihydro-5H-dibenzo[a,d]cyclohepten-5-ol; dibenzo(b,f)cycloheptan-1-ol; Dibenzo[b,f]-1-cycloheptanol; 10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-ol; 10,11-Dihydro-5H-dibenzo[a,d]cyclohetpten-5-ol |
| InChI | InChI=1/C15H14O/c16-15-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)15/h1-8,15-16H,9-10H2 |
| Molecular Formula | C15H14O |
| Molecular Weight | 210.2711 |
| Density | 1.163g/cm3 |
| Melting point | 90-95℃ |
| Boiling point | 365.5°C at 760 mmHg |
| Flash point | 135.6°C |
| Refractive index | 1.633 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
1210-34-0 dibenzosuberol
service@apichina.com
- Next:1210-35-1 dibenzosuberone
- Previous:1210-33-9 5-chlorodibenzosuberane