| Product Name | 4-chloro-5-hydrazino-2-phenyl-2,3-dihydropyridazin-3-one |
| CAS No. | 1210-32-8 |
| Synonyms | 4-Chloro-5-hydrazino-2-phenyl-3(2H)-pyridazinone; NSC 69010; 4-chloro-5-hydrazinyl-2-phenylpyridazin-3(2H)-one |
| InChI | InChI=1/C10H9ClN4O/c11-9-8(14-12)6-13-15(10(9)16)7-4-2-1-3-5-7/h1-6,14H,12H2 |
| Molecular Formula | C10H9ClN4O |
| Molecular Weight | 236.6577 |
| Density | 1.47g/cm3 |
| Melting point | 169℃ |
| Boiling point | 372.7°C at 760 mmHg |
| Flash point | 179.2°C |
| Refractive index | 1.686 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
1210-32-8 4-chloro-5-hydrazino-2-phenyl-2,3-dihydropyridazin-3-one
service@apichina.com