| Product Name | 3-Methoxycarbonylphenyl isothiocyanate |
| CAS No. | 3125-66-4 |
| Synonyms | Methyl 3-isothiocyanatobenzoate |
| InChI | InChI=1/C9H7NO2S/c1-12-9(11)7-3-2-4-8(5-7)10-6-13/h2-5H,1H3 |
| Molecular Formula | C9H7NO2S |
| Molecular Weight | 193.2224 |
| Density | 1.16g/cm3 |
| Boiling point | 323.2°C at 760 mmHg |
| Flash point | 149.2°C |
| Refractive index | 1.566 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
3125-66-4 3-methoxycarbonylphenyl isothiocyanate
service@apichina.com