| Product Name | 3-Acetylphenyl isothiocyanate |
| CAS No. | 3125-71-1 |
| Synonyms | 3-Isothiocyanatoacetophenone; 1-(3-isothiocyanatophenyl)ethanone |
| InChI | InChI=1/C9H7NOS/c1-7(11)8-3-2-4-9(5-8)10-6-12/h2-5H,1H3 |
| Molecular Formula | C9H7NOS |
| Molecular Weight | 177.223 |
| Density | 1.11g/cm3 |
| Boiling point | 324.4°C at 760 mmHg |
| Flash point | 150°C |
| Refractive index | 1.576 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
3125-71-1 3-acetylphenyl isothiocyanate
service@apichina.com