| Product Name | 3-Iodophenyl isothiocyanate |
| CAS No. | 3125-73-3 |
| Synonyms | 3-Iodophenylisothiocyanate; 1-Iodo-3-isothiocyanatobenzene; 3-IPI; Isothiocyanic acid, m-iodophenyl ester; m-Iodophenylisothiocyanate; Benzene, 1-iodo-3-isothiocyanato- |
| InChI | InChI=1/C7H4INS/c8-6-2-1-3-7(4-6)9-5-10/h1-4H |
| Molecular Formula | C7H4INS |
| Molecular Weight | 261.0828 |
| Density | 1.76g/cm3 |
| Boiling point | 318.1°C at 760 mmHg |
| Flash point | 146.2°C |
| Refractive index | 1.672 |
| Risk Codes | R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
3125-73-3 3-iodophenyl isothiocyanate
service@apichina.com