| Product Name | 3-Methoxyphenyl isothiocyanate |
| CAS No. | 3125-64-2 |
| Synonyms | m-Anisyl isothiocyanate; 3-(Isothiocyanato)-anisole |
| InChI | InChI=1/C8H7NOS/c1-10-8-4-2-3-7(5-8)9-6-11/h2-5H,1H3 |
| Molecular Formula | C8H7NOS |
| Molecular Weight | 165.20 |
| Density | 1.179 |
| Boiling point | 133℃(10 torr) |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
3125-64-2 3-methoxyphenyl isothiocyanate
service@apichina.com