| Product Name | Tris-(2-methoxyphenyl)-phosphine |
| CAS No. | 4731-65-1 |
| Synonyms | Tris(2-methoxyphenyl)phosphine; Tri(o-anisyl)phosphine; tris(2-methoxyphenyl)phosphane; Tris(o-methoxyphenyl)phosphine |
| InChI | InChI=1/C21H21O3P/c1-22-16-10-4-7-13-19(16)25(20-14-8-5-11-17(20)23-2)21-15-9-6-12-18(21)24-3/h4-15H,1-3H3 |
| Molecular Formula | C21H21O3P |
| Molecular Weight | 352.3634 |
| Boiling point | 477.3°C at 760 mmHg |
| Flash point | 302.5°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
4731-65-1 tris-(2-methoxyphenyl)-phosphine
service@apichina.com