| Product Name | Tri-n-octylphosphine |
| CAS No. | 4731-53-7 |
| Synonyms | Phosphine, trioctyl-; Trioctylphosphine; trioctylphosphane; Trioctyl phosphine |
| InChI | InChI=1/C24H51P/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3/h4-24H2,1-3H3 |
| Molecular Formula | C24H51P |
| Molecular Weight | 370.6355 |
| Boiling point | 445°C at 760 mmHg |
| Flash point | 236°C |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
4731-53-7 tri-n-octylphosphine
service@apichina.com