| Product Name | ticarcillin |
| CAS No. | 34787-01-4 |
| Synonyms | (2s,5r,6r)-6-[[(2r)-2-carboxy-2-thiophen-3-yl-acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid; 6-{[carboxy(thiophen-3-yl)acetyl]amino}-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid; (2S,5R,6R)-6-{[(2R)-2-carboxy-2-(thiophen-3-yl)acetyl]amino}-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid; (2S,5R,6R)-6-{[carboxy(thiophen-3-yl)acetyl]amino}-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| InChI | InChI=1/C15H16N2O6S2/c1-15(2)9(14(22)23)17-11(19)8(12(17)25-15)16-10(18)7(13(20)21)6-3-4-24-5-6/h3-5,7-9,12H,1-2H3,(H,16,18)(H,20,21)(H,22,23)/t7?,8-,9+,12-/m1/s1 |
| Molecular Formula | C15H16N2O6S2 |
| Molecular Weight | 384.4273 |
| Density | 1.62g/cm3 |
| Boiling point | 768.3°C at 760 mmHg |
| Flash point | 418.4°C |
| Refractive index | 1.693 |
34787-01-4 ticarcillin
service@apichina.com