| Product Name | 2-[4-(6-hydrazinopyridazin-3-yl)piperazin-1-yl]ethanol trihydrochloride |
| CAS No. | 56393-10-3 |
| InChI | InChI=1/C10H18N6O.3ClH/c11-12-9-1-2-10(14-13-9)16-5-3-15(4-6-16)7-8-17;;;/h1-2,17H,3-8,11H2,(H,12,13);3*1H |
| Molecular Formula | C10H21Cl3N6O |
| Molecular Weight | 347.6723 |
| Boiling point | 557.1°C at 760 mmHg |
| Flash point | 290.7°C |
56393-10-3 2-[4-(6-hydrazinopyridazin-3-yl)piperazin-1-yl]ethanol trihydrochloride
service@apichina.com