| Product Name | Thiophene-3-acetic acid hydrazide |
| CAS No. | 175276-94-5 |
| Synonyms | 2-(3-Thienyl)acetic acid hydrazide; 2-(3-Thienyl)ethanohydrazide; 2-thiophen-3-ylacetohydrazide |
| InChI | InChI=1/C6H8N2OS/c7-8-6(9)3-5-1-2-10-4-5/h1-2,4H,3,7H2,(H,8,9) |
| Molecular Formula | C6H8N2OS |
| Molecular Weight | 156.2055 |
| Density | 1.287g/cm3 |
| Melting point | 80℃ |
| Boiling point | 387.5°C at 760 mmHg |
| Flash point | 188.1°C |
| Refractive index | 1.597 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
175276-94-5 thiophene-3-acetic acid hydrazide
service@apichina.com