| Product Name | 2-[4-(4,5-dihydro-1,3-thiazol-2-yl)phenoxy]acetonitrile |
| CAS No. | 175276-95-6 |
| Synonyms | [4-(4,5-dihydro-1,3-thiazol-2-yl)phenoxy]acetonitrile |
| InChI | InChI=1/C11H10N2OS/c12-5-7-14-10-3-1-9(2-4-10)11-13-6-8-15-11/h1-4H,6-8H2 |
| Molecular Formula | C11H10N2OS |
| Molecular Weight | 218.2749 |
| Density | 1.24g/cm3 |
| Melting point | 83℃ |
| Boiling point | 404.7°C at 760 mmHg |
| Flash point | 198.5°C |
| Refractive index | 1.629 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
175276-95-6 2-[4-(4,5-dihydro-1,3-thiazol-2-yl)phenoxy]acetonitrile
service@apichina.com