| Product Name | Tetrahydroindene |
| CAS No. | 3048-65-5 |
| Synonyms | 3a,4,7,7a-Tetrahydroindene; 3a,4,7,7a-tetrahydro-1H-indene |
| InChI | InChI=1/C9H12/c1-2-5-9-7-3-6-8(9)4-1/h1-3,6,8-9H,4-5,7H2 |
| Molecular Formula | C9H12 |
| Molecular Weight | 120.1916 |
| Density | 0.944g/cm3 |
| Boiling point | 169.1°C at 760 mmHg |
| Flash point | 33.8°C |
| Refractive index | 1.521 |
| Risk Codes | R10:Flammable.; R65:Harmful: may cause lung damage if swallowed.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S23:Do not inhale gas/fumes/vapour/spray.; S36/37:Wear suitable protective clothing and gloves.; S62:If swallowed, do not induce vomiting: seek medical advice immediately and show this container or label.; |
3048-65-5 tetrahydroindene
service@apichina.com