| Product Name | 5-Vinyl-2-norbornene |
| CAS No. | 3048-64-4 |
| Synonyms | 5-Vinyl-2-norbornene,mixture of endo and exo; Vinylnorbornene; 2-ethenylbicyclo[2.2.1]hept-1-ene; 5-ethenylbicyclo[2.2.1]hept-1-ene |
| InChI | InChI=1/C9H12/c1-2-8-5-7-3-4-9(8)6-7/h2-3,8-9H,1,4-6H2 |
| Molecular Weight | C9H8 |
| Density | 1.612 |
| Melting point | -80℃ |
| Boiling point | 137.909°C |
| Flash point | 1.189g/cm3 |
| Refractive index | 144.1732 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R10:Flammable.; R20:Harmful by inhalation.; R36/38:Irritating to eyes and skin.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
3048-64-4 5-vinyl-2-norbornene
service@apichina.com