| Product Name | Tetrahydrofuran-2,4-dione |
| CAS No. | 4971-56-6 |
| Synonyms | Tetronicacidmin; beta-oxo-gamma-butyrolactone; 4-Hydroxy-2(5H)-furanone; Tetrahydro-2,4-furandione; 2,4(3H,5H)-Furandione; furan-2,4(3H,5H)-dione |
| InChI | InChI=1/C4H4O3/c5-3-1-4(6)7-2-3/h1-2H2 |
| Molecular Formula | C4H4O3 |
| Molecular Weight | 100.0728 |
| Density | 1.375g/cm3 |
| Melting point | 142-147℃ |
| Boiling point | 324.3°C at 760 mmHg |
| Flash point | 151.1°C |
| Refractive index | 1.47 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
4971-56-6 tetrahydrofuran-2,4-dione
service@apichina.com