| Product Name | 3-chloro-2,4(3H,5H)-furandione |
| CAS No. | 4971-55-5 |
| Synonyms | 3-chlorotetronic acid; 4-chloro-5-hydroxyfuran-3(2H)-one; 3-chlorofuran-2,4(3H,5H)-dione |
| InChI | InChI=1/C4H3ClO3/c5-3-2(6)1-8-4(3)7/h3H,1H2 |
| Molecular Formula | C4H3ClO3 |
| Molecular Weight | 134.5178 |
| Density | 1.51g/cm3 |
| Melting point | 208℃ |
| Boiling point | 364.5°C at 760 mmHg |
| Flash point | 192°C |
| Refractive index | 1.48 |
4971-55-5 3-chloro-2,4(3h,5h)-furandione
service@apichina.com