| Product Name | Tetrafluoro-p-benzoquinone |
| CAS No. | 527-21-9 |
| Synonyms | Tetrafluoro-p-benzoquinone~Tetrafluoro-1,4-benzoquinone; p-Fluoranil; 2,3,5,6-tetrafluorocyclohexa-2,5-diene-1,4-dione |
| InChI | InChI=1/C6F4O2/c7-1-2(8)6(12)4(10)3(9)5(1)11 |
| Molecular Formula | C6F4O2 |
| Molecular Weight | 180.0566 |
| Density | 1.62g/cm3 |
| Melting point | 183-186℃ |
| Boiling point | 133.1°C at 760 mmHg |
| Flash point | 44.6°C |
| Refractive index | 1.409 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S37:Wear suitable gloves.; |
527-21-9 tetrafluoro-p-benzoquinone
service@apichina.com