Product Name | Hexaketocyclohexane octahydrate |
CAS No. | 527-31-1 |
Synonyms | cyclohexanehexaone; Trquinoylhydrate; Hexaoxocyclohexane octahydrate; Triquinolyl octahydrate; Cyclohexanehexone; Trquinoyl; cyclohexane-1,2,3,4,5,6-hexone; cyclohexane-1,2,3,4,5,6-hexone octahydrate; cyclohexane-1,2,3,4,5,6-hexaone Octahydrate |
InChI | InChI=1/C6O6.8H2O/c7-1-2(8)4(10)6(12)5(11)3(1)9;;;;;;;;/h;8*1H2 |
Molecular Formula | C6H16O14 |
Molecular Weight | 312.1828 |
Melting point | 90-93℃ |
Boiling point | 344.7°C at 760 mmHg |
Flash point | 152°C |
Hazard Symbols | |
Risk Codes | R20/21:Harmful by inhalation and in contact with skin.; |
Safety | S23:Do not inhale gas/fumes/vapour/spray.; |
527-31-1 hexaketocyclohexane octahydrate
service@apichina.com