| Product Name | (S)-N-(3-Pentyl)-1-phenylethylamine hydrochloride |
| CAS No. | 374790-92-8 |
| Synonyms | (S)-N-(1-Ethylpropyl)-1-phenylethylamine hydrochloride; N-[(1S)-1-phenylethyl]pentan-3-amine hydrochloride |
| InChI | InChI=1/C13H21N.ClH/c1-4-13(5-2)14-11(3)12-9-7-6-8-10-12;/h6-11,13-14H,4-5H2,1-3H3;1H/t11-;/m0./s1 |
| Molecular Formula | C13H22ClN |
| Molecular Weight | 227.7735 |
| Boiling point | 290.9°C at 760 mmHg |
| Flash point | 129.7°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
374790-92-8 (s)-n-(3-pentyl)-1-phenylethylamine hydrochloride
service@apichina.com