| Product Name | (R)-N-(3-Pentyl)-1-phenylethylamine hydrochloride |
| CAS No. | 374790-91-7 |
| Synonyms | (R)-N-(1-Ethylpropyl)-1-phenylethylamine hydrochloride; N-[(1R)-1-phenylethyl]pentan-3-amine |
| InChI | InChI=1/C13H21N/c1-4-13(5-2)14-11(3)12-9-7-6-8-10-12/h6-11,13-14H,4-5H2,1-3H3/t11-/m1/s1 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.3125 |
| Density | 0.89g/cm3 |
| Boiling point | 254.6°C at 760 mmHg |
| Flash point | 94.8°C |
| Refractive index | 1.494 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
374790-91-7 (r)-n-(3-pentyl)-1-phenylethylamine hydrochloride
service@apichina.com