| Product Name | p-Tolyl chlorothionoformate |
| CAS No. | 937-63-3 |
| Synonyms | p-Tolyl chlorothioformate; O-(4-methylphenyl) carbonochloridothioate |
| InChI | InChI=1/C8H7ClOS/c1-6-2-4-7(5-3-6)10-8(9)11/h2-5H,1H3 |
| Molecular Formula | C8H7ClOS |
| Molecular Weight | 186.6586 |
| Density | 1.277g/cm3 |
| Boiling point | 244.8°C at 760 mmHg |
| Flash point | 101.8°C |
| Refractive index | 1.598 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
937-63-3 p-tolyl chlorothionoformate
service@apichina.com