| Product Name | 4-chlorophenyl chlorothionoformate |
| CAS No. | 937-64-4 |
| Synonyms | O-(4-Chlorophenyl chlorothioformate); O-(4-chlorophenyl) carbonochloridothioate; 4-chlorophenyl chlorothioformate |
| InChI | InChI=1/C7H4Cl2OS/c8-5-1-3-6(4-2-5)10-7(9)11/h1-4H |
| Molecular Formula | C7H4Cl2OS |
| Molecular Weight | 207.0771 |
| Density | 1.46g/cm3 |
| Boiling point | 251.7°C at 760 mmHg |
| Flash point | 106°C |
| Refractive index | 1.622 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
937-64-4 4-chlorophenyl chlorothionoformate
service@apichina.com