| Product Name | N,N-Dimethyl-5-methylfurfurylamine |
| CAS No. | 14496-35-6 |
| InChI | InChI=1/C8H13NO/c1-7-4-5-8(10-7)6-9(2)3/h4-5H,6H2,1-3H3 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.1949 |
| Density | 0.959g/cm3 |
| Boiling point | 150.5°C at 760 mmHg |
| Flash point | 44.8°C |
| Refractive index | 1.48 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
14496-35-6 n,n-dimethyl-5-methylfurfurylamine
service@apichina.com