| Product Name | 1-Diethylamino-2-butyne |
| CAS No. | 6323-82-6 |
| Synonyms | N,N-diethylbut-2-yn-1-amine; 1,3-dichloropropan-2-ol |
| InChI | InChI=1/C3H6Cl2O/c4-1-3(6)2-5/h3,6H,1-2H2 |
| Molecular Formula | C3H6Cl2O |
| Molecular Weight | 128.9851 |
| Density | 1.306g/cm3 |
| Boiling point | 174.3°C at 760 mmHg |
| Flash point | 85.6°C |
| Refractive index | 1.462 |
| Risk Codes | R10:Flammable.; R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
6323-82-6 1-diethylamino-2-butyne
service@apichina.com