| Product Name | N-Cyanoacetylmorpholine |
| CAS No. | 15029-32-0 |
| Synonyms | 4-(Cyanoacetyl)morpholine; 3-Morpholino-3-oxopropanenitrile; 2-(morpholin-4-yl)-3-oxopropanenitrile; 3-(morpholin-4-yl)-3-oxopropanenitrile |
| InChI | InChI=1/C7H10N2O2/c8-2-1-7(10)9-3-5-11-6-4-9/h1,3-6H2 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.1665 |
| Density | 1.188g/cm3 |
| Melting point | 86-88℃ |
| Boiling point | 356.4°C at 760 mmHg |
| Flash point | 169.3°C |
| Refractive index | 1.488 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
15029-32-0 n-cyanoacetylmorpholine
service@apichina.com