| Product Name | 1-Cyanoacetylpiperidine |
| CAS No. | 15029-30-8 |
| Synonyms | 3-oxo-3-piperidinopropanenitrile; 3-oxo-3-(piperidin-1-yl)propanenitrile |
| InChI | InChI=1/C8H12N2O/c9-5-4-8(11)10-6-2-1-3-7-10/h1-4,6-7H2 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.1937 |
| Density | 1.097g/cm3 |
| Melting point | 85-89℃ |
| Boiling point | 325.9°C at 760 mmHg |
| Flash point | 150.9°C |
| Refractive index | 1.494 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
15029-30-8 1-cyanoacetylpiperidine
service@apichina.com