| Product Name | N-Chloroacetyl-DL-isonipecotic acid |
| CAS No. | 318280-69-2 |
| Synonyms | 1-(Chloroacetyl)piperidine-4-carboxylic acid |
| InChI | InChI=1/C8H12ClNO3/c9-5-7(11)10-3-1-6(2-4-10)8(12)13/h6H,1-5H2,(H,12,13) |
| Molecular Formula | C8H12ClNO3 |
| Molecular Weight | 205.6388 |
| Density | 1.349g/cm3 |
| Boiling point | 406.2°C at 760 mmHg |
| Flash point | 199.4°C |
| Refractive index | 1.526 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
318280-69-2 n-chloroacetyl-dl-isonipecotic acid
service@apichina.com