| Product Name | ethyl 1-(2-chloroacetyl)-4-piperidinecarboxylate |
| CAS No. | 318280-71-6 |
| Synonyms | ethyl 1-(chloroacetyl)piperidine-4-carboxylate |
| InChI | InChI=1/C10H16ClNO3/c1-2-15-10(14)8-3-5-12(6-4-8)9(13)7-11/h8H,2-7H2,1H3 |
| Molecular Formula | C10H16ClNO3 |
| Molecular Weight | 233.6919 |
| Density | 1.202g/cm3 |
| Boiling point | 345.8°C at 760 mmHg |
| Flash point | 162.9°C |
| Refractive index | 1.49 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
318280-71-6 ethyl 1-(2-chloroacetyl)-4-piperidinecarboxylate
service@apichina.com