| Product Name | N-(4-amino-5-methoxy-2-methylphenyl)benzamide |
| CAS No. | 99-21-8 |
| Synonyms | Benzamide, N-(4-amino-5-methoxy-2-methylphenyl)-; 4'-Amino-5'-methoxy-2'-methylbenzanilide; 4-amino-5-methoxy-2-methyl-N-phenylbenzamide; Fast Violet Base B; FAST VIOLER B BASE |
| InChI | InChI=1/C15H16N2O2/c1-10-8-13(16)14(19-2)9-12(10)15(18)17-11-6-4-3-5-7-11/h3-9H,16H2,1-2H3,(H,17,18) |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.2997 |
| Density | 1.215g/cm3 |
| Melting point | 185℃ |
| Boiling point | 384.7°C at 760 mmHg |
| Flash point | 186.5°C |
| Refractive index | 1.646 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
99-21-8 n-(4-amino-5-methoxy-2-methylphenyl)benzamide
service@apichina.com