| Product Name | D-Trehalose anhydrous |
| CAS No. | 99-20-7 |
| Synonyms | Trehalose; alpha-D-Trehalose; alpha-D-glucopyranosyl alpha-D-glucopyranoside; Trehalose; D(+)Trehalose; D-(+)-Trehalose; α-L-glucopyranosyl; α-D-glucopyranoside; Trehalose anhydrous |
| InChI | InChI=1/C12H22O11/c13-1-3-5(15)7(17)9(19)11(21-3)23-12-10(20)8(18)6(16)4(2-14)22-12/h3-20H,1-2H2/t3-,4-,5-,6-,7+,8+,9-,10-,11-,12-/m1/s1 |
| Molecular Formula | C12H22O11 |
| Molecular Weight | 342.2965 |
| Density | 1.76g/cm3 |
| Melting point | 214-216℃ |
| Boiling point | 675.4°C at 760 mmHg |
| Flash point | 362.3°C |
| Refractive index | 1.652 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
99-20-7 d-trehalose anhydrous
service@apichina.com