| Product Name | N-(2-Hydroxyphenyl)piperazine |
| CAS No. | 1011-17-2 |
| Synonyms | 1-(2-Hydroxyphenyl)piperazine; 2-(1-Piperazino)phenol; 2-(piperazin-1-yl)phenol; 4-(2-hydroxyphenyl)piperazin-1-ium; N-(2-Hydroxyphenyl) piperazine hcl |
| InChI | InChI=1/C10H14N2O/c13-10-4-2-1-3-9(10)12-7-5-11-6-8-12/h1-4,11,13H,5-8H2/p+1 |
| Molecular Formula | C10H15N2O |
| Molecular Weight | 179.2384 |
| Boiling point | 328.2°C at 760 mmHg |
| Flash point | 152.3°C |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
1011-17-2 n-(2-hydroxyphenyl)piperazine
service@apichina.com