| Product Name | 1-(2-fluorophenyl)piperazine monohydro-chloride, |
| CAS No. | 1011-16-1 |
| Synonyms | 1-(2-Fluorophenyl)piperazine monohydrochloride; 1-(2-fluorophenyl)piperazine hydrochloride; 1-(2-fluorophenyl)piperazine hcl; |
| InChI | InChI=1/C10H13FN2.ClH/c11-9-3-1-2-4-10(9)13-7-5-12-6-8-13;/h1-4,12H,5-8H2;1H |
| Molecular Formula | C10H14ClFN2 |
| Molecular Weight | 216.683 |
| Melting point | 187℃ |
| Boiling point | 283.8°C at 760 mmHg |
| Flash point | 125.4°C |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
1011-16-1 1-(2-fluorophenyl)piperazine monohydro-chloride,
service@apichina.com