| Product Name | methyl 4-(hydroxymethyl)-1,2,5-trimethyl-1H-pyrrole-3-carboxylate |
| CAS No. | 368869-98-1 |
| InChI | InChI=1/C10H15NO3/c1-6-8(5-12)9(10(13)14-4)7(2)11(6)3/h12H,5H2,1-4H3 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.231 |
| Density | 1.13g/cm3 |
| Boiling point | 353°C at 760 mmHg |
| Flash point | 167.3°C |
| Refractive index | 1.516 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
368869-98-1 methyl 4-(hydroxymethyl)-1,2,5-trimethyl-1h-pyrrole-3-carboxylate
service@apichina.com