| Product Name | 2-(2,3-dihydro-1-benzofuran-5-yl)-1,3-thiazole-4-carboxylic acid |
| CAS No. | 368869-97-0 |
| InChI | InChI=1/C12H9NO3S/c14-12(15)9-6-17-11(13-9)8-1-2-10-7(5-8)3-4-16-10/h1-2,5-6H,3-4H2,(H,14,15) |
| Molecular Formula | C12H9NO3S |
| Molecular Weight | 247.2698 |
| Density | 1.453g/cm3 |
| Melting point | 210℃ |
| Boiling point | 490.3°C at 760 mmHg |
| Flash point | 250.3°C |
| Refractive index | 1.668 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
368869-97-0 2-(2,3-dihydro-1-benzofuran-5-yl)-1,3-thiazole-4-carboxylic acid
service@apichina.com