| Product Name | Methyl 3-methoxy-4-nitrobenzoate |
| CAS No. | 5081-37-8 |
| Synonyms | 3-Methoxy-4-nitrobenzoic acid methyl ester; acid methyl ester |
| InChI | InChI=1/C9H9NO5/c1-14-8-5-6(9(11)15-2)3-4-7(8)10(12)13/h3-5H,1-2H3 |
| Molecular Formula | C9H9NO5 |
| Molecular Weight | 211.1715 |
| Density | 1.294g/cm3 |
| Melting point | 86-88℃ |
| Boiling point | 350.7°C at 760 mmHg |
| Flash point | 168.3°C |
| Refractive index | 1.54 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
5081-37-8 methyl 3-methoxy-4-nitrobenzoate
service@apichina.com