| Product Name | Methyl 2-nitro-3,4,5-trimethoxybenzoate |
| CAS No. | 5081-42-5 |
| Synonyms | 2-Nitro-3,4,5-trimethoxybenzoic acid methyl ester; methyl 3,4,5-trimethoxy-2-nitrobenzoate |
| InChI | InChI=1/C11H13NO7/c1-16-7-5-6(11(13)19-4)8(12(14)15)10(18-3)9(7)17-2/h5H,1-4H3 |
| Molecular Formula | C11H13NO7 |
| Molecular Weight | 271.2234 |
| Density | 1.284g/cm3 |
| Boiling point | 420°C at 760 mmHg |
| Flash point | 188.9°C |
| Refractive index | 1.523 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
5081-42-5 methyl 2-nitro-3,4,5-trimethoxybenzoate
service@apichina.com