| Product Name | Methyl-2,4-dihydroxy-3,6-dimethylbenzoate |
| CAS No. | 4707-47-5 |
| InChI | InChI=1/C10H12O4/c1-5-4-7(11)6(2)9(12)8(5)10(13)14-3/h4,11-12H,1-3H3 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.1999 |
| Density | 1.251g/cm3 |
| Boiling point | 360.7°C at 760 mmHg |
| Flash point | 143.9°C |
| Refractive index | 1.57 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
4707-47-5 methyl-2,4-dihydroxy-3,6-dimethylbenzoate
service@apichina.com